C21H24N5O2+ — CID 8756295
[(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]azanium (PubChem CID 8756295) has the molecular formula C21H24N5O2+ and a molecular weight of 378.46 g/mol. Its IUPAC name is [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]azanium.
| Compound Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]azanium |
|---|---|
| PubChem CID | 8756295 |
| Molecular Formula | C21H24N5O2+ |
| Molecular Weight | 378.46 g/mol |
| Exact Mass | 378.19 |
| IUPAC Name | [(R)-furan-2-yl(phenyl)methyl]-[2-oxo-2-(4-pyrimidin-2-ylpiperazin-1-yl)ethyl]azanium |
| SMILES | O=C(C[NH2+][C@H](c1ccccc1)c1ccco1)N1CCN(c2ncccn2)CC1 |
| InChI | InChI=1S/C21H23N5O2/c27-19(25-11-13-26(14-12-25)21-22-9-5-10-23-21)16-24-20(18-8-4-15-28-18)17-6-2-1-3-7-17/h1-10,15,20,24H,11-14,16H2/p+1/t20-/m1/s1 |
| InChIKey | UAWFFCJOVUYIHN-HXUWFJFHSA-O |
| XLogP | 1.07 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.46 |
| LogP ≤ 5 | 1.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |