C10H12N2O3S — CID 112780791
1-[2-(furan-2-ylmethylsulfanyl)acetyl]imidazolidin-2-one (PubChem CID 112780791) has the molecular formula C10H12N2O3S and a molecular weight of 240.28 g/mol. Its IUPAC name is 1-[2-(furan-2-ylmethylsulfanyl)acetyl]imidazolidin-2-one.
| Compound Name | 1-[2-(furan-2-ylmethylsulfanyl)acetyl]imidazolidin-2-one |
|---|---|
| PubChem CID | 112780791 |
| Molecular Formula | C10H12N2O3S |
| Molecular Weight | 240.28 g/mol |
| Exact Mass | 240.06 |
| IUPAC Name | 1-[2-(furan-2-ylmethylsulfanyl)acetyl]imidazolidin-2-one |
| SMILES | O=C(CSCc1ccco1)N1CCNC1=O |
| InChI | InChI=1S/C10H12N2O3S/c13-9(12-4-3-11-10(12)14)7-16-6-8-2-1-5-15-8/h1-2,5H,3-4,6-7H2,(H,11,14) |
| InChIKey | JDJFFHNRDKFIMM-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 62.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.28 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |