C18H26Cl2N3O2S+ — CID 8621562
N-butyl-2-[4-[2-(2,6-dichlorophenyl)sulfanylacetyl]piperazin-1-ium-1-yl]acetamide (PubChem CID 8621562) has the molecular formula C18H26Cl2N3O2S+ and a molecular weight of 419.40 g/mol. Its IUPAC name is N-butyl-2-[4-[2-(2,6-dichlorophenyl)sulfanylacetyl]piperazin-1-ium-1-yl]acetamide.
| Compound Name | N-butyl-2-[4-[2-(2,6-dichlorophenyl)sulfanylacetyl]piperazin-1-ium-1-yl]acetamide |
|---|---|
| PubChem CID | 8621562 |
| Molecular Formula | C18H26Cl2N3O2S+ |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | N-butyl-2-[4-[2-(2,6-dichlorophenyl)sulfanylacetyl]piperazin-1-ium-1-yl]acetamide |
| SMILES | CCCCNC(=O)C[NH+]1CCN(C(=O)CSc2c(Cl)cccc2Cl)CC1 |
| InChI | InChI=1S/C18H25Cl2N3O2S/c1-2-3-7-21-16(24)12-22-8-10-23(11-9-22)17(25)13-26-18-14(19)5-4-6-15(18)20/h4-6H,2-3,7-13H2,1H3,(H,21,24)/p+1 |
| InChIKey | NSNCVVTYHVNFBI-UHFFFAOYSA-O |
| XLogP | 1.73 |
| TPSA | 53.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|