C19H19ClN3O3+ — CID 7873618
N-(5-chloro-2-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide (PubChem CID 7873618) has the molecular formula C19H19ClN3O3+ and a molecular weight of 372.83 g/mol. Its IUPAC name is N-(5-chloro-2-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide.
| Compound Name | N-(5-chloro-2-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 7873618 |
| Molecular Formula | C19H19ClN3O3+ |
| Molecular Weight | 372.83 g/mol |
| Exact Mass | 372.11 |
| IUPAC Name | N-(5-chloro-2-nitrophenyl)-2-(4-phenyl-1,2,3,6-tetrahydropyridin-1-ium-1-yl)acetamide |
| SMILES | O=C(C[NH+]1CC=C(c2ccccc2)CC1)Nc1cc(Cl)ccc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18ClN3O3/c20-16-6-7-18(23(25)26)17(12-16)21-19(24)13-22-10-8-15(9-11-22)14-4-2-1-3-5-14/h1-8,12H,9-11,13H2,(H,21,24)/p+1 |
| InChIKey | VNUCTCJNKVXKSP-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|