C22H31N4O3+ — CID 9325765
1-[[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide (PubChem CID 9325765) has the molecular formula C22H31N4O3+ and a molecular weight of 399.52 g/mol. Its IUPAC name is 1-[[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide.
| Compound Name | 1-[[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 9325765 |
| Molecular Formula | C22H31N4O3+ |
| Molecular Weight | 399.52 g/mol |
| Exact Mass | 399.24 |
| IUPAC Name | 1-[[(5S,6R)-6-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl]methyl]-N-phenylpiperidin-1-ium-4-carboxamide |
| SMILES | C[C@@H]1CCCC[C@]12NC(=O)N(C[NH+]1CCC(C(=O)Nc3ccccc3)CC1)C2=O |
| InChI | InChI=1S/C22H30N4O3/c1-16-7-5-6-12-22(16)20(28)26(21(29)24-22)15-25-13-10-17(11-14-25)19(27)23-18-8-3-2-4-9-18/h2-4,8-9,16-17H,5-7,10-15H2,1H3,(H,23,27)(H,24,29)/p+1/t16-,22+/m1/s1 |
| InChIKey | ZXEOQSTURBQKTM-ZHRRBRCNSA-O |
| XLogP | 1.38 |
| TPSA | 82.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.52 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|