C23H33N4O3+ — CID 9320017
(5S)-3-[[4-(azepane-1-carbonyl)piperidin-1-ium-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione (PubChem CID 9320017) has the molecular formula C23H33N4O3+ and a molecular weight of 413.54 g/mol. Its IUPAC name is (5S)-3-[[4-(azepane-1-carbonyl)piperidin-1-ium-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[4-(azepane-1-carbonyl)piperidin-1-ium-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9320017 |
| Molecular Formula | C23H33N4O3+ |
| Molecular Weight | 413.54 g/mol |
| Exact Mass | 413.25 |
| IUPAC Name | (5S)-3-[[4-(azepane-1-carbonyl)piperidin-1-ium-1-yl]methyl]-5-methyl-5-phenylimidazolidine-2,4-dione |
| SMILES | C[C@@]1(c2ccccc2)NC(=O)N(C[NH+]2CCC(C(=O)N3CCCCCC3)CC2)C1=O |
| InChI | InChI=1S/C23H32N4O3/c1-23(19-9-5-4-6-10-19)21(29)27(22(30)24-23)17-25-15-11-18(12-16-25)20(28)26-13-7-2-3-8-14-26/h4-6,9-10,18H,2-3,7-8,11-17H2,1H3,(H,24,30)/p+1/t23-/m0/s1 |
| InChIKey | GMRIGWUMIBWNBH-QHCPKHFHSA-O |
| XLogP | 1.11 |
| TPSA | 74.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.54 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|