C21H25N4O2+ — CID 2641564
(5R)-5-methyl-5-phenyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione (PubChem CID 2641564) has the molecular formula C21H25N4O2+ and a molecular weight of 365.46 g/mol. Its IUPAC name is (5R)-5-methyl-5-phenyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5R)-5-methyl-5-phenyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2641564 |
| Molecular Formula | C21H25N4O2+ |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.20 |
| IUPAC Name | (5R)-5-methyl-5-phenyl-3-[(4-phenylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccccc2)NC(=O)N(C[NH+]2CCN(c3ccccc3)CC2)C1=O |
| InChI | InChI=1S/C21H24N4O2/c1-21(17-8-4-2-5-9-17)19(26)25(20(27)22-21)16-23-12-14-24(15-13-23)18-10-6-3-7-11-18/h2-11H,12-16H2,1H3,(H,22,27)/p+1/t21-/m1/s1 |
| InChIKey | RKWVDQIZFWSLFP-OAQYLSRUSA-O |
| XLogP | 0.82 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|