C21H27N5O3+2 — CID 9280265
(5S)-5-(3-methoxyphenyl)-5-methyl-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione (PubChem CID 9280265) has the molecular formula C21H27N5O3+2 and a molecular weight of 397.48 g/mol. Its IUPAC name is (5S)-5-(3-methoxyphenyl)-5-methyl-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | (5S)-5-(3-methoxyphenyl)-5-methyl-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9280265 |
| Molecular Formula | C21H27N5O3+2 |
| Molecular Weight | 397.48 g/mol |
| Exact Mass | 397.21 |
| IUPAC Name | (5S)-5-(3-methoxyphenyl)-5-methyl-3-[(4-pyridin-1-ium-4-ylpiperazin-1-ium-1-yl)methyl]imidazolidine-2,4-dione |
| SMILES | COc1cccc([C@]2(C)NC(=O)N(C[NH+]3CCN(c4cc[nH+]cc4)CC3)C2=O)c1 |
| InChI | InChI=1S/C21H25N5O3/c1-21(16-4-3-5-18(14-16)29-2)19(27)26(20(28)23-21)15-24-10-12-25(13-11-24)17-6-8-22-9-7-17/h3-9,14H,10-13,15H2,1-2H3,(H,23,28)/p+2/t21-/m0/s1 |
| InChIKey | MOQSEJLCJYKSEY-NRFANRHFSA-P |
| XLogP | -0.36 |
| TPSA | 80.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.48 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|