C22H25ClN4O3 — CID 2573818
(5S)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione (PubChem CID 2573818) has the molecular formula C22H25ClN4O3 and a molecular weight of 428.92 g/mol. Its IUPAC name is (5S)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5S)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2573818 |
| Molecular Formula | C22H25ClN4O3 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | (5S)-3-[[4-(3-chlorophenyl)piperazin-1-yl]methyl]-5-(3-methoxyphenyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COc1cccc([C@]2(C)NC(=O)N(CN3CCN(c4cccc(Cl)c4)CC3)C2=O)c1 |
| InChI | InChI=1S/C22H25ClN4O3/c1-22(16-5-3-8-19(13-16)30-2)20(28)27(21(29)24-22)15-25-9-11-26(12-10-25)18-7-4-6-17(23)14-18/h3-8,13-14H,9-12,15H2,1-2H3,(H,24,29)/t22-/m0/s1 |
| InChIKey | SBMZPDXQXQAZEY-QFIPXVFZSA-N |
| XLogP | 2.90 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|