C26H34N4O3 — CID 55351953
5-(4-tert-butylphenyl)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 55351953) has the molecular formula C26H34N4O3 and a molecular weight of 450.58 g/mol. Its IUPAC name is 5-(4-tert-butylphenyl)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-tert-butylphenyl)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 55351953 |
| Molecular Formula | C26H34N4O3 |
| Molecular Weight | 450.58 g/mol |
| Exact Mass | 450.26 |
| IUPAC Name | 5-(4-tert-butylphenyl)-3-[[4-(4-methoxyphenyl)piperazin-1-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(N2CCN(CN3C(=O)NC(C)(c4ccc(C(C)(C)C)cc4)C3=O)CC2)cc1 |
| InChI | InChI=1S/C26H34N4O3/c1-25(2,3)19-6-8-20(9-7-19)26(4)23(31)30(24(32)27-26)18-28-14-16-29(17-15-28)21-10-12-22(33-5)13-11-21/h6-13H,14-18H2,1-5H3,(H,27,32) |
| InChIKey | GMELBTIPYIUIEI-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 65.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.58 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|