C24H29N3O4 — CID 9403675
3-(azepan-1-ylmethyl)-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 9403675) has the molecular formula C24H29N3O4 and a molecular weight of 423.51 g/mol. Its IUPAC name is 3-(azepan-1-ylmethyl)-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-(azepan-1-ylmethyl)-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 9403675 |
| Molecular Formula | C24H29N3O4 |
| Molecular Weight | 423.51 g/mol |
| Exact Mass | 423.22 |
| IUPAC Name | 3-(azepan-1-ylmethyl)-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(CN3CCCCCC3)C2=O)cc1 |
| InChI | InChI=1S/C24H29N3O4/c1-30-20-11-7-18(8-12-20)24(19-9-13-21(31-2)14-10-19)22(28)27(23(29)25-24)17-26-15-5-3-4-6-16-26/h7-14H,3-6,15-17H2,1-2H3,(H,25,29) |
| InChIKey | OEGVJTWXKRTTFW-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 71.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.51 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|