C27H29N3O5 — CID 42984685
3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione (PubChem CID 42984685) has the molecular formula C27H29N3O5 and a molecular weight of 475.55 g/mol. Its IUPAC name is 3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42984685 |
| Molecular Formula | C27H29N3O5 |
| Molecular Weight | 475.55 g/mol |
| Exact Mass | 475.21 |
| IUPAC Name | 3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5,5-bis(4-methoxyphenyl)imidazolidine-2,4-dione |
| SMILES | CCn1c(C)cc(C(=O)CN2C(=O)NC(c3ccc(OC)cc3)(c3ccc(OC)cc3)C2=O)c1C |
| InChI | InChI=1S/C27H29N3O5/c1-6-29-17(2)15-23(18(29)3)24(31)16-30-25(32)27(28-26(30)33,19-7-11-21(34-4)12-8-19)20-9-13-22(35-5)14-10-20/h7-15H,6,16H2,1-5H3,(H,28,33) |
| InChIKey | AFYRNMUTWODBMP-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 89.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.55 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|