C23H29N3O3 — CID 46815456
3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione (PubChem CID 46815456) has the molecular formula C23H29N3O3 and a molecular weight of 395.50 g/mol. Its IUPAC name is 3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46815456 |
| Molecular Formula | C23H29N3O3 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.22 |
| IUPAC Name | 3-[2-(1-ethyl-2,5-dimethylpyrrol-3-yl)-2-oxoethyl]-5-methyl-5-(4-propylphenyl)imidazolidine-2,4-dione |
| SMILES | CCCc1ccc(C2(C)NC(=O)N(CC(=O)c3cc(C)n(CC)c3C)C2=O)cc1 |
| InChI | InChI=1S/C23H29N3O3/c1-6-8-17-9-11-18(12-10-17)23(5)21(28)26(22(29)24-23)14-20(27)19-13-15(3)25(7-2)16(19)4/h9-13H,6-8,14H2,1-5H3,(H,24,29) |
| InChIKey | ATWDXHVLXYGRHB-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 71.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|