C28H24N2O4 — CID 2090016
5,5-bis(4-methoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione (PubChem CID 2090016) has the molecular formula C28H24N2O4 and a molecular weight of 452.51 g/mol. Its IUPAC name is 5,5-bis(4-methoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-bis(4-methoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2090016 |
| Molecular Formula | C28H24N2O4 |
| Molecular Weight | 452.51 g/mol |
| Exact Mass | 452.17 |
| IUPAC Name | 5,5-bis(4-methoxyphenyl)-3-(naphthalen-1-ylmethyl)imidazolidine-2,4-dione |
| SMILES | COc1ccc(C2(c3ccc(OC)cc3)NC(=O)N(Cc3cccc4ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C28H24N2O4/c1-33-23-14-10-21(11-15-23)28(22-12-16-24(34-2)17-13-22)26(31)30(27(32)29-28)18-20-8-5-7-19-6-3-4-9-25(19)20/h3-17H,18H2,1-2H3,(H,29,32) |
| InChIKey | BRNHZZFSYNMULA-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.51 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|