C22H17BrN2O2 — CID 26018170
3-[(2-bromophenyl)methyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 26018170) has the molecular formula C22H17BrN2O2 and a molecular weight of 421.29 g/mol. Its IUPAC name is 3-[(2-bromophenyl)methyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[(2-bromophenyl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 26018170 |
| Molecular Formula | C22H17BrN2O2 |
| Molecular Weight | 421.29 g/mol |
| Exact Mass | 420.05 |
| IUPAC Name | 3-[(2-bromophenyl)methyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1ccccc1Br |
| InChI | InChI=1S/C22H17BrN2O2/c23-19-14-8-7-9-16(19)15-25-20(26)22(24-21(25)27,17-10-3-1-4-11-17)18-12-5-2-6-13-18/h1-14H,15H2,(H,24,27) |
| InChIKey | GYNGYRAYTFAVSK-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.29 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|