C16H14N2O4P+ — CID 173376528
(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methoxy-oxophosphanium (PubChem CID 173376528) has the molecular formula C16H14N2O4P+ and a molecular weight of 329.27 g/mol. Its IUPAC name is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methoxy-oxophosphanium.
| Compound Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methoxy-oxophosphanium |
|---|---|
| PubChem CID | 173376528 |
| Molecular Formula | C16H14N2O4P+ |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 329.07 |
| IUPAC Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methoxy-oxophosphanium |
| SMILES | O=[PH+]OCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C16H13N2O4P/c19-14-16(12-7-3-1-4-8-12,13-9-5-2-6-10-13)17-15(20)18(14)11-22-23-21/h1-10,23H,11H2/p+1 |
| InChIKey | QVIVAWPXZRHVSS-UHFFFAOYSA-O |
| XLogP | 2.40 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|