C18H14Cl3N3O3 — CID 23650796
(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl 2,2,2-trichloroethanimidate (PubChem CID 23650796) has the molecular formula C18H14Cl3N3O3 and a molecular weight of 426.69 g/mol. Its IUPAC name is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl 2,2,2-trichloroethanimidate.
| Compound Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl 2,2,2-trichloroethanimidate |
|---|---|
| PubChem CID | 23650796 |
| Molecular Formula | C18H14Cl3N3O3 |
| Molecular Weight | 426.69 g/mol |
| Exact Mass | 425.01 |
| IUPAC Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl 2,2,2-trichloroethanimidate |
| SMILES | [H]/N=C(/OCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C18H14Cl3N3O3/c19-18(20,21)14(22)27-11-24-15(25)17(23-16(24)26,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,22H,11H2,(H,23,26)/b22-14+ |
| InChIKey | UQDYTOKWAYUNRU-HYARGMPZSA-N |
| XLogP | 3.80 |
| TPSA | 82.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.69 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|