C20H21N5O3 — CID 145280331
2-[(2R)-1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2-methyl-3-oxopropan-2-yl]guanidine (PubChem CID 145280331) has the molecular formula C20H21N5O3 and a molecular weight of 379.42 g/mol. Its IUPAC name is 2-[(2R)-1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2-methyl-3-oxopropan-2-yl]guanidine.
| Compound Name | 2-[(2R)-1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2-methyl-3-oxopropan-2-yl]guanidine |
|---|---|
| PubChem CID | 145280331 |
| Molecular Formula | C20H21N5O3 |
| Molecular Weight | 379.42 g/mol |
| Exact Mass | 379.16 |
| IUPAC Name | 2-[(2R)-1-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-2-methyl-3-oxopropan-2-yl]guanidine |
| SMILES | C[C@](C=O)(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)N=C(N)N |
| InChI | InChI=1S/C20H21N5O3/c1-19(13-26,23-17(21)22)12-25-16(27)20(24-18(25)28,14-8-4-2-5-9-14)15-10-6-3-7-11-15/h2-11,13H,12H2,1H3,(H,24,28)(H4,21,22,23)/t19-/m1/s1 |
| InChIKey | QRPMOIUNJBQQHO-LJQANCHMSA-N |
| XLogP | 0.71 |
| TPSA | 130.88 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.42 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|