C19H17N3O4S — CID 23467951
S-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl] 2-formamidoethanethioate (PubChem CID 23467951) has the molecular formula C19H17N3O4S and a molecular weight of 383.43 g/mol. Its IUPAC name is S-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl] 2-formamidoethanethioate.
| Compound Name | S-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl] 2-formamidoethanethioate |
|---|---|
| PubChem CID | 23467951 |
| Molecular Formula | C19H17N3O4S |
| Molecular Weight | 383.43 g/mol |
| Exact Mass | 383.09 |
| IUPAC Name | S-[(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl] 2-formamidoethanethioate |
| SMILES | O=CNCC(=O)SCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O |
| InChI | InChI=1S/C19H17N3O4S/c23-12-20-11-16(24)27-13-22-17(25)19(21-18(22)26,14-7-3-1-4-8-14)15-9-5-2-6-10-15/h1-10,12H,11,13H2,(H,20,23)(H,21,26) |
| InChIKey | MNDUJKHJUZLUHF-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.43 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|