C25H24N2O2S — CID 2221675
5,5-diphenyl-3-(4-phenylsulfanylbutyl)imidazolidine-2,4-dione (PubChem CID 2221675) has the molecular formula C25H24N2O2S and a molecular weight of 416.55 g/mol. Its IUPAC name is 5,5-diphenyl-3-(4-phenylsulfanylbutyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-3-(4-phenylsulfanylbutyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2221675 |
| Molecular Formula | C25H24N2O2S |
| Molecular Weight | 416.55 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 5,5-diphenyl-3-(4-phenylsulfanylbutyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCCSc1ccccc1 |
| InChI | InChI=1S/C25H24N2O2S/c28-23-25(20-12-4-1-5-13-20,21-14-6-2-7-15-21)26-24(29)27(23)18-10-11-19-30-22-16-8-3-9-17-22/h1-9,12-17H,10-11,18-19H2,(H,26,29) |
| InChIKey | DSNMDPJFONXBJN-UHFFFAOYSA-N |
| XLogP | 5.05 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.55 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|