C30H30N4O2 — CID 22960997
3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 22960997) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22960997 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(CCCN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C30H30N4O2/c1-31-29(24-12-5-2-6-13-24)18-22-33(23-19-29)20-11-21-34-27(35)30(32-28(34)36,25-14-7-3-8-15-25)26-16-9-4-10-17-26/h2-10,12-17H,11,18-23H2,(H,32,36) |
| InChIKey | TZEIRLFZEAJZNN-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|