C33H36N4O2 — CID 22960995
3-[3-(4-isocyano-4-phenylpiperidin-1-yl)-2-methylpropyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione (PubChem CID 22960995) has the molecular formula C33H36N4O2 and a molecular weight of 520.68 g/mol. Its IUPAC name is 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)-2-methylpropyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione.
| Compound Name | 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)-2-methylpropyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22960995 |
| Molecular Formula | C33H36N4O2 |
| Molecular Weight | 520.68 g/mol |
| Exact Mass | 520.28 |
| IUPAC Name | 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)-2-methylpropyl]-5,5-bis(4-methylphenyl)imidazolidine-2,4-dione |
| SMILES | [C-]#[N+]C1(c2ccccc2)CCN(CC(C)CN2C(=O)NC(c3ccc(C)cc3)(c3ccc(C)cc3)C2=O)CC1 |
| InChI | InChI=1S/C33H36N4O2/c1-24-10-14-28(15-11-24)33(29-16-12-25(2)13-17-29)30(38)37(31(39)35-33)23-26(3)22-36-20-18-32(34-4,19-21-36)27-8-6-5-7-9-27/h5-17,26H,18-23H2,1-3H3,(H,35,39) |
| InChIKey | XWFHXDHIVUGABF-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.68 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|