C25H29ClN4O2 — CID 158461626
3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5-methyl-5-phenylimidazolidine-2,4-dione;hydrochloride (PubChem CID 158461626) has the molecular formula C25H29ClN4O2 and a molecular weight of 452.99 g/mol. Its IUPAC name is 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5-methyl-5-phenylimidazolidine-2,4-dione;hydrochloride.
| Compound Name | 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5-methyl-5-phenylimidazolidine-2,4-dione;hydrochloride |
|---|---|
| PubChem CID | 158461626 |
| Molecular Formula | C25H29ClN4O2 |
| Molecular Weight | 452.99 g/mol |
| Exact Mass | 452.20 |
| IUPAC Name | 3-[3-(4-isocyano-4-phenylpiperidin-1-yl)propyl]-5-methyl-5-phenylimidazolidine-2,4-dione;hydrochloride |
| SMILES | Cl.[C-]#[N+]C1(c2ccccc2)CCN(CCCN2C(=O)NC(C)(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C25H28N4O2.ClH/c1-24(20-10-5-3-6-11-20)22(30)29(23(31)27-24)17-9-16-28-18-14-25(26-2,15-19-28)21-12-7-4-8-13-21;/h3-8,10-13H,9,14-19H2,1H3,(H,27,31);1H |
| InChIKey | JVRAKARFGQLQNZ-UHFFFAOYSA-N |
| XLogP | 4.18 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.99 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|