C30H30N4O2 — CID 10299367
1-[3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propyl]-4-phenylpiperidine-4-carbonitrile (PubChem CID 10299367) has the molecular formula C30H30N4O2 and a molecular weight of 478.60 g/mol. Its IUPAC name is 1-[3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propyl]-4-phenylpiperidine-4-carbonitrile.
| Compound Name | 1-[3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propyl]-4-phenylpiperidine-4-carbonitrile |
|---|---|
| PubChem CID | 10299367 |
| Molecular Formula | C30H30N4O2 |
| Molecular Weight | 478.60 g/mol |
| Exact Mass | 478.24 |
| IUPAC Name | 1-[3-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)propyl]-4-phenylpiperidine-4-carbonitrile |
| SMILES | N#CC1(c2ccccc2)CCN(CCCN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)CC1 |
| InChI | InChI=1S/C30H30N4O2/c31-23-29(24-11-4-1-5-12-24)17-21-33(22-18-29)19-10-20-34-27(35)30(32-28(34)36,25-13-6-2-7-14-25)26-15-8-3-9-16-26/h1-9,11-16H,10,17-22H2,(H,32,36) |
| InChIKey | CASGLPHEHPUYMV-UHFFFAOYSA-N |
| XLogP | 4.43 |
| TPSA | 76.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.60 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|