C25H22FN3O3 — CID 2087814
2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide (PubChem CID 2087814) has the molecular formula C25H22FN3O3 and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide.
| Compound Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
|---|---|
| PubChem CID | 2087814 |
| Molecular Formula | C25H22FN3O3 |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.16 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)-N-[2-(4-fluorophenyl)ethyl]acetamide |
| SMILES | O=C(CN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)NCCc1ccc(F)cc1 |
| InChI | InChI=1S/C25H22FN3O3/c26-21-13-11-18(12-14-21)15-16-27-22(30)17-29-23(31)25(28-24(29)32,19-7-3-1-4-8-19)20-9-5-2-6-10-20/h1-14H,15-17H2,(H,27,30)(H,28,32) |
| InChIKey | VUKHMHXXIYLDHR-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|