About Doxenitoin
Doxenitoin (PubChem CID 18622) has the molecular formula C15H14N2O
and a molecular weight of 238.28 g/mol. Its IUPAC name is 5,5-diphenylimidazolidin-4-one.
Molecular Properties
| Compound Name | Doxenitoin |
| PubChem CID | 18622 |
| Molecular Formula | C15H14N2O |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.11 |
| IUPAC Name | 5,5-diphenylimidazolidin-4-one |
| SMILES | C1NC(=O)C(N1)(C2=CC=CC=C2)C3=CC=CC=C3 |
| InChI | InChI=1S/C15H14N2O/c18-14-15(17-11-16-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,17H,11H2,(H,16,18) |
| InChIKey | FEJIIZAOQRTGPC-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 41.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | 286 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze Doxenitoin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Doxenitoin?
The IUPAC name of Doxenitoin (CID 18622) is 5,5-diphenylimidazolidin-4-one.
What is the SMILES notation for Doxenitoin?
The canonical SMILES for Doxenitoin is C1NC(=O)C(N1)(C2=CC=CC=C2)C3=CC=CC=C3.
What is the InChIKey of Doxenitoin?
The InChIKey is FEJIIZAOQRTGPC-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H14N2O/c18-14-15(17-11-16-14,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10,17H,11H2,(H,16,18).
What are the key properties of Doxenitoin?
Doxenitoin has a molecular weight of 238.28 g/mol, XLogP of 2.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for Doxenitoin is sourced from PubChem (CID 18622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).