About Fosphenytoin
Fosphenytoin (PubChem CID 56339) has the molecular formula C16H15N2O6P
and a molecular weight of 362.27 g/mol. Its IUPAC name is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl dihydrogen phosphate.
Molecular Properties
| Compound Name | Fosphenytoin |
| PubChem CID | 56339 |
| Molecular Formula | C16H15N2O6P |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 362.07 |
| IUPAC Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl dihydrogen phosphate |
| SMILES | C1=CC=C(C=C1)C2(C(=O)N(C(=O)N2)COP(=O)(O)O)C3=CC=CC=C3 |
| InChI | InChI=1S/C16H15N2O6P/c19-14-16(12-7-3-1-4-8-12,13-9-5-2-6-10-13)17-15(20)18(14)11-24-25(21,22)23/h1-10H,11H2,(H,17,20)(H2,21,22,23) |
| InChIKey | XWLUWCNOOVRFPX-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 116.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | 547 |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze Fosphenytoin with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Fosphenytoin?
The IUPAC name of Fosphenytoin (CID 56339) is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl dihydrogen phosphate.
What is the SMILES notation for Fosphenytoin?
The canonical SMILES for Fosphenytoin is C1=CC=C(C=C1)C2(C(=O)N(C(=O)N2)COP(=O)(O)O)C3=CC=CC=C3.
What is the InChIKey of Fosphenytoin?
The InChIKey is XWLUWCNOOVRFPX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15N2O6P/c19-14-16(12-7-3-1-4-8-12,13-9-5-2-6-10-13)17-15(20)18(14)11-24-25(21,22)23/h1-10H,11H2,(H,17,20)(H2,21,22,23).
What are the key properties of Fosphenytoin?
Fosphenytoin has a molecular weight of 362.27 g/mol, XLogP of 0.60, 5 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for Fosphenytoin is sourced from PubChem (CID 56339), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).