C17H15N3O3 — CID 2107999
2-(2,5-Dioxo-4,4-diphenylimidazolidin-1-yl)acetamide (PubChem CID 2107999) has the molecular formula C17H15N3O3 and a molecular weight of 309.32 g/mol. Its IUPAC name is 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide.
| Compound Name | 2-(2,5-Dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
|---|---|
| PubChem CID | 2107999 |
| Molecular Formula | C17H15N3O3 |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.11 |
| IUPAC Name | 2-(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)acetamide |
| SMILES | C1=CC=C(C=C1)C2(C(=O)N(C(=O)N2)CC(=O)N)C3=CC=CC=C3 |
| InChI | InChI=1S/C17H15N3O3/c18-14(21)11-20-15(22)17(19-16(20)23,12-7-3-1-4-8-12)13-9-5-2-6-10-13/h1-10H,11H2,(H2,18,21)(H,19,23) |
| InChIKey | NDZLOKLSRGOUOB-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | 475 |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|