C28H30N4O2 — CID 21395250
5-phenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]-5-pyridin-4-ylimidazolidine-2,4-dione (PubChem CID 21395250) has the molecular formula C28H30N4O2 and a molecular weight of 454.57 g/mol. Its IUPAC name is 5-phenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]-5-pyridin-4-ylimidazolidine-2,4-dione.
| Compound Name | 5-phenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]-5-pyridin-4-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 21395250 |
| Molecular Formula | C28H30N4O2 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.24 |
| IUPAC Name | 5-phenyl-3-[3-(4-phenylpiperidin-1-yl)propyl]-5-pyridin-4-ylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccncc2)C(=O)N1CCCN1CCC(c2ccccc2)CC1 |
| InChI | InChI=1S/C28H30N4O2/c33-26-28(24-10-5-2-6-11-24,25-12-16-29-17-13-25)30-27(34)32(26)19-7-18-31-20-14-23(15-21-31)22-8-3-1-4-9-22/h1-6,8-13,16-17,23H,7,14-15,18-21H2,(H,30,34) |
| InChIKey | RCYLZMNKASDGTJ-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 65.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|