C18H18N2O2S — CID 102066490
5,5-diphenyl-3-(3-sulfanylpropyl)imidazolidine-2,4-dione (PubChem CID 102066490) has the molecular formula C18H18N2O2S and a molecular weight of 326.42 g/mol. Its IUPAC name is 5,5-diphenyl-3-(3-sulfanylpropyl)imidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-3-(3-sulfanylpropyl)imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 102066490 |
| Molecular Formula | C18H18N2O2S |
| Molecular Weight | 326.42 g/mol |
| Exact Mass | 326.11 |
| IUPAC Name | 5,5-diphenyl-3-(3-sulfanylpropyl)imidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCS |
| InChI | InChI=1S/C18H18N2O2S/c21-16-18(14-8-3-1-4-9-14,15-10-5-2-6-11-15)19-17(22)20(16)12-7-13-23/h1-6,8-11,23H,7,12-13H2,(H,19,22) |
| InChIKey | PBJIFBUUAQXLDF-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.42 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|