C24H21N3O5 — CID 2221340
3-[3-(2-nitrophenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 2221340) has the molecular formula C24H21N3O5 and a molecular weight of 431.45 g/mol. Its IUPAC name is 3-[3-(2-nitrophenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[3-(2-nitrophenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2221340 |
| Molecular Formula | C24H21N3O5 |
| Molecular Weight | 431.45 g/mol |
| Exact Mass | 431.15 |
| IUPAC Name | 3-[3-(2-nitrophenoxy)propyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1CCCOc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C24H21N3O5/c28-22-24(18-10-3-1-4-11-18,19-12-5-2-6-13-19)25-23(29)26(22)16-9-17-32-21-15-8-7-14-20(21)27(30)31/h1-8,10-15H,9,16-17H2,(H,25,29) |
| InChIKey | UVQHWNHZJDNFHA-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 101.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.45 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|