C27H26N2O4 — CID 2221626
3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 2221626) has the molecular formula C27H26N2O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 2221626 |
| Molecular Formula | C27H26N2O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.19 |
| IUPAC Name | 3-[2-[2-methoxy-4-[(E)-prop-1-enyl]phenoxy]ethyl]-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | C/C=C/c1ccc(OCCN2C(=O)NC(c3ccccc3)(c3ccccc3)C2=O)c(OC)c1 |
| InChI | InChI=1S/C27H26N2O4/c1-3-10-20-15-16-23(24(19-20)32-2)33-18-17-29-25(30)27(28-26(29)31,21-11-6-4-7-12-21)22-13-8-5-9-14-22/h3-16,19H,17-18H2,1-2H3,(H,28,31)/b10-3+ |
| InChIKey | NMTREAKTNYSALF-XCVCLJGOSA-N |
| XLogP | 4.60 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|