C21H18BrN3O4 — CID 43028357
2-[3-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione (PubChem CID 43028357) has the molecular formula C21H18BrN3O4 and a molecular weight of 456.30 g/mol. Its IUPAC name is 2-[3-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione.
| Compound Name | 2-[3-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 43028357 |
| Molecular Formula | C21H18BrN3O4 |
| Molecular Weight | 456.30 g/mol |
| Exact Mass | 455.05 |
| IUPAC Name | 2-[3-[4-(3-bromophenyl)-4-methyl-2,5-dioxoimidazolidin-1-yl]propyl]isoindole-1,3-dione |
| SMILES | CC1(c2cccc(Br)c2)NC(=O)N(CCCN2C(=O)c3ccccc3C2=O)C1=O |
| InChI | InChI=1S/C21H18BrN3O4/c1-21(13-6-4-7-14(22)12-13)19(28)25(20(29)23-21)11-5-10-24-17(26)15-8-2-3-9-16(15)18(24)27/h2-4,6-9,12H,5,10-11H2,1H3,(H,23,29) |
| InChIKey | WLSRJMGJIRMTJI-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.30 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|