C29H36N4O2 — CID 22960992
3-[3-[4-isocyano-4-(2-methylphenyl)piperidin-1-yl]propyl]-5-(4-methylphenyl)-5-propan-2-ylimidazolidine-2,4-dione (PubChem CID 22960992) has the molecular formula C29H36N4O2 and a molecular weight of 472.63 g/mol. Its IUPAC name is 3-[3-[4-isocyano-4-(2-methylphenyl)piperidin-1-yl]propyl]-5-(4-methylphenyl)-5-propan-2-ylimidazolidine-2,4-dione.
| Compound Name | 3-[3-[4-isocyano-4-(2-methylphenyl)piperidin-1-yl]propyl]-5-(4-methylphenyl)-5-propan-2-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22960992 |
| Molecular Formula | C29H36N4O2 |
| Molecular Weight | 472.63 g/mol |
| Exact Mass | 472.28 |
| IUPAC Name | 3-[3-[4-isocyano-4-(2-methylphenyl)piperidin-1-yl]propyl]-5-(4-methylphenyl)-5-propan-2-ylimidazolidine-2,4-dione |
| SMILES | [C-]#[N+]C1(c2ccccc2C)CCN(CCCN2C(=O)NC(c3ccc(C)cc3)(C(C)C)C2=O)CC1 |
| InChI | InChI=1S/C29H36N4O2/c1-21(2)29(24-13-11-22(3)12-14-24)26(34)33(27(35)31-29)18-8-17-32-19-15-28(30-5,16-20-32)25-10-7-6-9-23(25)4/h6-7,9-14,21H,8,15-20H2,1-4H3,(H,31,35) |
| InChIKey | QOBYARXDEPSGNJ-UHFFFAOYSA-N |
| XLogP | 5.01 |
| TPSA | 57.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.63 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|