C34H37N3O3 — CID 22961000
5,5-bis(4-methylphenyl)-3-[4-(2-oxospiro[1H-indene-3,4'-piperidine]-1'-yl)butyl]imidazolidine-2,4-dione (PubChem CID 22961000) has the molecular formula C34H37N3O3 and a molecular weight of 535.69 g/mol. Its IUPAC name is 5,5-bis(4-methylphenyl)-3-[4-(2-oxospiro[1H-indene-3,4'-piperidine]-1'-yl)butyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-bis(4-methylphenyl)-3-[4-(2-oxospiro[1H-indene-3,4'-piperidine]-1'-yl)butyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 22961000 |
| Molecular Formula | C34H37N3O3 |
| Molecular Weight | 535.69 g/mol |
| Exact Mass | 535.28 |
| IUPAC Name | 5,5-bis(4-methylphenyl)-3-[4-(2-oxospiro[1H-indene-3,4'-piperidine]-1'-yl)butyl]imidazolidine-2,4-dione |
| SMILES | Cc1ccc(C2(c3ccc(C)cc3)NC(=O)N(CCCCN3CCC4(CC3)C(=O)Cc3ccccc34)C2=O)cc1 |
| InChI | InChI=1S/C34H37N3O3/c1-24-9-13-27(14-10-24)34(28-15-11-25(2)12-16-28)31(39)37(32(40)35-34)20-6-5-19-36-21-17-33(18-22-36)29-8-4-3-7-26(29)23-30(33)38/h3-4,7-16H,5-6,17-23H2,1-2H3,(H,35,40) |
| InChIKey | FYRDUOYUTGALRS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.69 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|