C33H29N3O6 — CID 10257300
(2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate (PubChem CID 10257300) has the molecular formula C33H29N3O6 and a molecular weight of 563.61 g/mol. Its IUPAC name is (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate.
| Compound Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
|---|---|
| PubChem CID | 10257300 |
| Molecular Formula | C33H29N3O6 |
| Molecular Weight | 563.61 g/mol |
| Exact Mass | 563.21 |
| IUPAC Name | (2,5-dioxo-4,4-diphenylimidazolidin-1-yl)methyl (2R)-3-phenyl-2-(phenylmethoxycarbonylamino)propanoate |
| SMILES | O=C(N[C@H](Cc1ccccc1)C(=O)OCN1C(=O)NC(c2ccccc2)(c2ccccc2)C1=O)OCc1ccccc1 |
| InChI | InChI=1S/C33H29N3O6/c37-29(28(21-24-13-5-1-6-14-24)34-32(40)41-22-25-15-7-2-8-16-25)42-23-36-30(38)33(35-31(36)39,26-17-9-3-10-18-26)27-19-11-4-12-20-27/h1-20,28H,21-23H2,(H,34,40)(H,35,39)/t28-/m1/s1 |
| InChIKey | IAPAPRMQZZVLJI-MUUNZHRXSA-N |
| XLogP | 4.52 |
| TPSA | 114.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.61 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|