C26H20N2O2 — CID 7916945
3-(naphthalen-1-ylmethyl)-5,5-diphenylimidazolidine-2,4-dione (PubChem CID 7916945) has the molecular formula C26H20N2O2 and a molecular weight of 392.46 g/mol. Its IUPAC name is 3-(naphthalen-1-ylmethyl)-5,5-diphenylimidazolidine-2,4-dione.
| Compound Name | 3-(naphthalen-1-ylmethyl)-5,5-diphenylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 7916945 |
| Molecular Formula | C26H20N2O2 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | 3-(naphthalen-1-ylmethyl)-5,5-diphenylimidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1cccc2ccccc12 |
| InChI | InChI=1S/C26H20N2O2/c29-24-26(21-13-3-1-4-14-21,22-15-5-2-6-16-22)27-25(30)28(24)18-20-12-9-11-19-10-7-8-17-23(19)20/h1-17H,18H2,(H,27,30) |
| InChIKey | WGSGRIKWOYKDSP-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|