C25H19N3O3 — CID 29336701
5,5-diphenyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 29336701) has the molecular formula C25H19N3O3 and a molecular weight of 409.45 g/mol. Its IUPAC name is 5,5-diphenyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5,5-diphenyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 29336701 |
| Molecular Formula | C25H19N3O3 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.14 |
| IUPAC Name | 5,5-diphenyl-3-[(2-phenyl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | O=C1NC(c2ccccc2)(c2ccccc2)C(=O)N1Cc1coc(-c2ccccc2)n1 |
| InChI | InChI=1S/C25H19N3O3/c29-23-25(19-12-6-2-7-13-19,20-14-8-3-9-15-20)27-24(30)28(23)16-21-17-31-22(26-21)18-10-4-1-5-11-18/h1-15,17H,16H2,(H,27,30) |
| InChIKey | RHTMCFONHKKWEC-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|