C24H18ClN3O3 — CID 46582960
3-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione (PubChem CID 46582960) has the molecular formula C24H18ClN3O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is 3-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46582960 |
| Molecular Formula | C24H18ClN3O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-[[2-(4-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-methyl-5-naphthalen-1-ylimidazolidine-2,4-dione |
| SMILES | CC1(c2cccc3ccccc23)NC(=O)N(Cc2coc(-c3ccc(Cl)cc3)n2)C1=O |
| InChI | InChI=1S/C24H18ClN3O3/c1-24(20-8-4-6-15-5-2-3-7-19(15)20)22(29)28(23(30)27-24)13-18-14-31-21(26-18)16-9-11-17(25)12-10-16/h2-12,14H,13H2,1H3,(H,27,30) |
| InChIKey | KKLCTGAXSFALOU-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|