C22H20ClN3O3 — CID 42946045
5-(4-chlorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 42946045) has the molecular formula C22H20ClN3O3 and a molecular weight of 409.87 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(4-chlorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 42946045 |
| Molecular Formula | C22H20ClN3O3 |
| Molecular Weight | 409.87 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 5-(4-chlorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CN3C(=O)NC(C)(c4ccc(Cl)cc4)C3=O)co2)c(C)c1 |
| InChI | InChI=1S/C22H20ClN3O3/c1-13-4-9-18(14(2)10-13)19-24-17(12-29-19)11-26-20(27)22(3,25-21(26)28)15-5-7-16(23)8-6-15/h4-10,12H,11H2,1-3H3,(H,25,28) |
| InChIKey | DQHBPQCPKDRBRK-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.87 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|