C22H19F2N3O3 — CID 46604342
5-(3,4-difluorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 46604342) has the molecular formula C22H19F2N3O3 and a molecular weight of 411.41 g/mol. Its IUPAC name is 5-(3,4-difluorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | 5-(3,4-difluorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 46604342 |
| Molecular Formula | C22H19F2N3O3 |
| Molecular Weight | 411.41 g/mol |
| Exact Mass | 411.14 |
| IUPAC Name | 5-(3,4-difluorophenyl)-3-[[2-(2,4-dimethylphenyl)-1,3-oxazol-4-yl]methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | Cc1ccc(-c2nc(CN3C(=O)NC(C)(c4ccc(F)c(F)c4)C3=O)co2)c(C)c1 |
| InChI | InChI=1S/C22H19F2N3O3/c1-12-4-6-16(13(2)8-12)19-25-15(11-30-19)10-27-20(28)22(3,26-21(27)29)14-5-7-17(23)18(24)9-14/h4-9,11H,10H2,1-3H3,(H,26,29) |
| InChIKey | NRXIWKVVHYPHLH-UHFFFAOYSA-N |
| XLogP | 4.20 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.41 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|