C18H14ClN3O4 — CID 47037834
3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 47037834) has the molecular formula C18H14ClN3O4 and a molecular weight of 371.78 g/mol. Its IUPAC name is 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 47037834 |
| Molecular Formula | C18H14ClN3O4 |
| Molecular Weight | 371.78 g/mol |
| Exact Mass | 371.07 |
| IUPAC Name | 3-[[2-(3-chlorophenyl)-1,3-oxazol-4-yl]methyl]-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccco2)NC(=O)N(Cc2coc(-c3cccc(Cl)c3)n2)C1=O |
| InChI | InChI=1S/C18H14ClN3O4/c1-18(14-6-3-7-25-14)16(23)22(17(24)21-18)9-13-10-26-15(20-13)11-4-2-5-12(19)8-11/h2-8,10H,9H2,1H3,(H,21,24) |
| InChIKey | ZIDWQBFPJTWJCL-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 88.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.78 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|