C17H16N2O5 — CID 94820088
(5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 94820088) has the molecular formula C17H16N2O5 and a molecular weight of 328.32 g/mol. Its IUPAC name is (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 94820088 |
| Molecular Formula | C17H16N2O5 |
| Molecular Weight | 328.32 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(furan-2-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | C[C@]1(c2ccco2)NC(=O)N(Cc2ccc3c(c2)OCCO3)C1=O |
| InChI | InChI=1S/C17H16N2O5/c1-17(14-3-2-6-24-14)15(20)19(16(21)18-17)10-11-4-5-12-13(9-11)23-8-7-22-12/h2-6,9H,7-8,10H2,1H3,(H,18,21)/t17-/m1/s1 |
| InChIKey | DAJJOUDYOPEDTN-QGZVFWFLSA-N |
| XLogP | 2.02 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.32 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|