C15H18N2O5 — CID 95307087
(5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(methoxymethyl)-5-methylimidazolidine-2,4-dione (PubChem CID 95307087) has the molecular formula C15H18N2O5 and a molecular weight of 306.32 g/mol. Its IUPAC name is (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(methoxymethyl)-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(methoxymethyl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 95307087 |
| Molecular Formula | C15H18N2O5 |
| Molecular Weight | 306.32 g/mol |
| Exact Mass | 306.12 |
| IUPAC Name | (5R)-3-(2,3-dihydro-1,4-benzodioxin-6-ylmethyl)-5-(methoxymethyl)-5-methylimidazolidine-2,4-dione |
| SMILES | COC[C@@]1(C)NC(=O)N(Cc2ccc3c(c2)OCCO3)C1=O |
| InChI | InChI=1S/C15H18N2O5/c1-15(9-20-2)13(18)17(14(19)16-15)8-10-3-4-11-12(7-10)22-6-5-21-11/h3-4,7H,5-6,8-9H2,1-2H3,(H,16,19)/t15-/m1/s1 |
| InChIKey | SWZMNTFUCRLSBK-OAHLLOKOSA-N |
| XLogP | 0.91 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.32 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|