C21H22N2O4 — CID 75853918
5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione (PubChem CID 75853918) has the molecular formula C21H22N2O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 75853918 |
| Molecular Formula | C21H22N2O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.16 |
| IUPAC Name | 5-(3,4-dihydro-2H-1,5-benzodioxepin-7-yl)-5-methyl-3-[(3-methylphenyl)methyl]imidazolidine-2,4-dione |
| SMILES | Cc1cccc(CN2C(=O)NC(C)(c3ccc4c(c3)OCCCO4)C2=O)c1 |
| InChI | InChI=1S/C21H22N2O4/c1-14-5-3-6-15(11-14)13-23-19(24)21(2,22-20(23)25)16-7-8-17-18(12-16)27-10-4-9-26-17/h3,5-8,11-12H,4,9-10,13H2,1-2H3,(H,22,25) |
| InChIKey | JVYJVJMQMGTSLP-UHFFFAOYSA-N |
| XLogP | 3.12 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|