C19H16Cl2N2O4 — CID 4780986
3-[(2,6-dichlorophenyl)methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione (PubChem CID 4780986) has the molecular formula C19H16Cl2N2O4 and a molecular weight of 407.25 g/mol. Its IUPAC name is 3-[(2,6-dichlorophenyl)methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione.
| Compound Name | 3-[(2,6-dichlorophenyl)methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 4780986 |
| Molecular Formula | C19H16Cl2N2O4 |
| Molecular Weight | 407.25 g/mol |
| Exact Mass | 406.05 |
| IUPAC Name | 3-[(2,6-dichlorophenyl)methyl]-5-(2,3-dihydro-1,4-benzodioxin-6-yl)-5-methylimidazolidine-2,4-dione |
| SMILES | CC1(c2ccc3c(c2)OCCO3)NC(=O)N(Cc2c(Cl)cccc2Cl)C1=O |
| InChI | InChI=1S/C19H16Cl2N2O4/c1-19(11-5-6-15-16(9-11)27-8-7-26-15)17(24)23(18(25)22-19)10-12-13(20)3-2-4-14(12)21/h2-6,9H,7-8,10H2,1H3,(H,22,25) |
| InChIKey | GPZGIZDIVUCWKZ-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.25 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|