C17H18N2O4 — CID 125419949
(5R)-5-(furan-2-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-5-methylimidazolidine-2,4-dione (PubChem CID 125419949) has the molecular formula C17H18N2O4 and a molecular weight of 314.34 g/mol. Its IUPAC name is (5R)-5-(furan-2-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-5-methylimidazolidine-2,4-dione.
| Compound Name | (5R)-5-(furan-2-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-5-methylimidazolidine-2,4-dione |
|---|---|
| PubChem CID | 125419949 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | (5R)-5-(furan-2-yl)-3-[(4-methoxy-3-methylphenyl)methyl]-5-methylimidazolidine-2,4-dione |
| SMILES | COc1ccc(CN2C(=O)N[C@](C)(c3ccco3)C2=O)cc1C |
| InChI | InChI=1S/C17H18N2O4/c1-11-9-12(6-7-13(11)22-3)10-19-15(20)17(2,18-16(19)21)14-5-4-8-23-14/h4-9H,10H2,1-3H3,(H,18,21)/t17-/m1/s1 |
| InChIKey | NUTINNXPAAIMOK-QGZVFWFLSA-N |
| XLogP | 2.56 |
| TPSA | 71.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|