C22H17N3O3S — CID 112787610
5-methyl-5-naphthalen-1-yl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 112787610) has the molecular formula C22H17N3O3S and a molecular weight of 403.46 g/mol. Its IUPAC name is 5-methyl-5-naphthalen-1-yl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-naphthalen-1-yl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112787610 |
| Molecular Formula | C22H17N3O3S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.10 |
| IUPAC Name | 5-methyl-5-naphthalen-1-yl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2cccc3ccccc23)NC(=O)N(Cc2coc(-c3cccs3)n2)C1=O |
| InChI | InChI=1S/C22H17N3O3S/c1-22(17-9-4-7-14-6-2-3-8-16(14)17)20(26)25(21(27)24-22)12-15-13-28-19(23-15)18-10-5-11-29-18/h2-11,13H,12H2,1H3,(H,24,27) |
| InChIKey | ZAFQTFDZVHHEDV-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|