C18H14N4O5S — CID 78766976
5-methyl-5-(4-nitrophenyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 78766976) has the molecular formula C18H14N4O5S and a molecular weight of 398.40 g/mol. Its IUPAC name is 5-methyl-5-(4-nitrophenyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-methyl-5-(4-nitrophenyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 78766976 |
| Molecular Formula | C18H14N4O5S |
| Molecular Weight | 398.40 g/mol |
| Exact Mass | 398.07 |
| IUPAC Name | 5-methyl-5-(4-nitrophenyl)-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc([N+](=O)[O-])cc2)NC(=O)N(Cc2coc(-c3cccs3)n2)C1=O |
| InChI | InChI=1S/C18H14N4O5S/c1-18(11-4-6-13(7-5-11)22(25)26)16(23)21(17(24)20-18)9-12-10-27-15(19-12)14-3-2-8-28-14/h2-8,10H,9H2,1H3,(H,20,24) |
| InChIKey | JRKAJCLASJTNGR-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 118.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.40 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|