C19H15F2N3O4S — CID 112787633
5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione (PubChem CID 112787633) has the molecular formula C19H15F2N3O4S and a molecular weight of 419.41 g/mol. Its IUPAC name is 5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione.
| Compound Name | 5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
|---|---|
| PubChem CID | 112787633 |
| Molecular Formula | C19H15F2N3O4S |
| Molecular Weight | 419.41 g/mol |
| Exact Mass | 419.08 |
| IUPAC Name | 5-[4-(difluoromethoxy)phenyl]-5-methyl-3-[(2-thiophen-2-yl-1,3-oxazol-4-yl)methyl]imidazolidine-2,4-dione |
| SMILES | CC1(c2ccc(OC(F)F)cc2)NC(=O)N(Cc2coc(-c3cccs3)n2)C1=O |
| InChI | InChI=1S/C19H15F2N3O4S/c1-19(11-4-6-13(7-5-11)28-17(20)21)16(25)24(18(26)23-19)9-12-10-27-15(22-12)14-3-2-8-29-14/h2-8,10,17H,9H2,1H3,(H,23,26) |
| InChIKey | BGAPSFONHKTGOO-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 84.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.41 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|